C20H26N4O3 — CID 120877878
2-(2-methoxy-4-prop-2-enylphenoxy)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 120877878) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-2-enylphenoxy)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 120877878 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | C=CCc1ccc(OCC(=O)N2CCNCC2c2nccn2C)c(OC)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-4-5-15-6-7-17(18(12-15)26-3)27-14-19(25)24-11-8-21-13-16(24)20-22-9-10-23(20)2/h4,6-7,9-10,12,16,21H,1,5,8,11,13-14H2,2-3H3 |
| InChIKey | FYYOPKDIGGZOSJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|