C17H23ClN4O2 — CID 120878371
2-(2-methoxyphenyl)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethanone;hydrochloride (PubChem CID 120878371) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(2-methoxyphenyl)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120878371 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethanone;hydrochloride |
| SMILES | COc1ccccc1CC(=O)N1CCNCC1c1nccn1C.Cl |
| InChI | InChI=1S/C17H22N4O2.ClH/c1-20-9-8-19-17(20)14-12-18-7-10-21(14)16(22)11-13-5-3-4-6-15(13)23-2;/h3-6,8-9,14,18H,7,10-12H2,1-2H3;1H |
| InChIKey | KOQJFRLCOAHWGJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |