C13H20Cl2N6O — CID 120879343
1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-pyrazol-1-ylethanone;dihydrochloride (PubChem CID 120879343) has the molecular formula C13H20Cl2N6O and a molecular weight of 347.25 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-pyrazol-1-ylethanone;dihydrochloride.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-pyrazol-1-ylethanone;dihydrochloride |
|---|---|
| PubChem CID | 120879343 |
| Molecular Formula | C13H20Cl2N6O |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-pyrazol-1-ylethanone;dihydrochloride |
| SMILES | Cl.Cl.Cn1ccnc1C1CNCCN1C(=O)Cn1cccn1 |
| InChI | InChI=1S/C13H18N6O.2ClH/c1-17-7-5-15-13(17)11-9-14-4-8-19(11)12(20)10-18-6-2-3-16-18;;/h2-3,5-7,11,14H,4,8-10H2,1H3;2*1H |
| InChIKey | QOUBJJVWYNDQCQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |