C15H22N6O3 — CID 120877268
5,5-dimethyl-1-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 120877268) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 5,5-dimethyl-1-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120877268 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 5,5-dimethyl-1-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cn1ccnc1C1CNCCN1C(=O)CN1C(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C15H22N6O3/c1-15(2)13(23)18-14(24)21(15)9-11(22)20-7-4-16-8-10(20)12-17-5-6-19(12)3/h5-6,10,16H,4,7-9H2,1-3H3,(H,18,23,24) |
| InChIKey | SNNMWFSBPJUIGI-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|