C19H27ClN4O2 — CID 120878055
3-(4-ethoxyphenyl)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 120878055) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-(4-ethoxyphenyl)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120878055 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | CCOc1ccc(CCC(=O)N2CCNCC2c2nccn2C)cc1.Cl |
| InChI | InChI=1S/C19H26N4O2.ClH/c1-3-25-16-7-4-15(5-8-16)6-9-18(24)23-13-10-20-14-17(23)19-21-11-12-22(19)2;/h4-5,7-8,11-12,17,20H,3,6,9-10,13-14H2,1-2H3;1H |
| InChIKey | XLHJDSGACWAHMV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |