C17H22N4OS — CID 120879518
1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-3-phenylsulfanylpropan-1-one (PubChem CID 120879518) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-3-phenylsulfanylpropan-1-one.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-3-phenylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 120879518 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-3-phenylsulfanylpropan-1-one |
| SMILES | Cn1ccnc1C1CNCCN1C(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C17H22N4OS/c1-20-10-9-19-17(20)15-13-18-8-11-21(15)16(22)7-12-23-14-5-3-2-4-6-14/h2-6,9-10,15,18H,7-8,11-13H2,1H3 |
| InChIKey | GXIDSODYHTWAET-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |