C17H23ClN4OS — CID 120877675
1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-phenylsulfanylpropan-1-one;hydrochloride (PubChem CID 120877675) has the molecular formula C17H23ClN4OS and a molecular weight of 366.92 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-phenylsulfanylpropan-1-one;hydrochloride.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-phenylsulfanylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120877675 |
| Molecular Formula | C17H23ClN4OS |
| Molecular Weight | 366.92 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-phenylsulfanylpropan-1-one;hydrochloride |
| SMILES | CC(Sc1ccccc1)C(=O)N1CCNCC1c1nccn1C.Cl |
| InChI | InChI=1S/C17H22N4OS.ClH/c1-13(23-14-6-4-3-5-7-14)17(22)21-11-8-18-12-15(21)16-19-9-10-20(16)2;/h3-7,9-10,13,15,18H,8,11-12H2,1-2H3;1H |
| InChIKey | KUGGCDWEOXOQJH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.92 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |