C21H23NO4 — CID 60552901
1-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone (PubChem CID 60552901) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone.
| Compound Name | 1-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone |
|---|---|
| PubChem CID | 60552901 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone |
| SMILES | C=CCc1ccc(OCC(=O)N2CCOc3ccccc3C2)c(OC)c1 |
| InChI | InChI=1S/C21H23NO4/c1-3-6-16-9-10-19(20(13-16)24-2)26-15-21(23)22-11-12-25-18-8-5-4-7-17(18)14-22/h3-5,7-10,13H,1,6,11-12,14-15H2,2H3 |
| InChIKey | XRFKQFAAGQAWRY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|