C27H30N2O6 — CID 110069075
3-(3,4-dimethoxyphenyl)-1-(2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)propan-1-one (PubChem CID 110069075) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-(2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)propan-1-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-(2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)propan-1-one |
|---|---|
| PubChem CID | 110069075 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-(2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCOCCOc3ccccc3Oc3ncccc3C2)cc1OC |
| InChI | InChI=1S/C27H30N2O6/c1-31-22-11-9-20(18-25(22)32-2)10-12-26(30)29-14-15-33-16-17-34-23-7-3-4-8-24(23)35-27-21(19-29)6-5-13-28-27/h3-9,11,13,18H,10,12,14-17,19H2,1-2H3 |
| InChIKey | RSVTWQSDIVRRKN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |