C19H27NO3 — CID 112788449
N-cyclohexyl-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide (PubChem CID 112788449) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 112788449 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-cyclohexyl-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide |
| SMILES | C=CCc1ccc(OCC(=O)N(C)C2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C19H27NO3/c1-4-8-15-11-12-17(18(13-15)22-3)23-14-19(21)20(2)16-9-6-5-7-10-16/h4,11-13,16H,1,5-10,14H2,2-3H3 |
| InChIKey | RHKCYKSLARPSJO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|