C11H20N2O2 — CID 120571061
1-(2,3-dimethylpiperazin-1-yl)-2-prop-2-enoxyethanone (PubChem CID 120571061) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(2,3-dimethylpiperazin-1-yl)-2-prop-2-enoxyethanone.
| Compound Name | 1-(2,3-dimethylpiperazin-1-yl)-2-prop-2-enoxyethanone |
|---|---|
| PubChem CID | 120571061 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-(2,3-dimethylpiperazin-1-yl)-2-prop-2-enoxyethanone |
| SMILES | C=CCOCC(=O)N1CCNC(C)C1C |
| InChI | InChI=1S/C11H20N2O2/c1-4-7-15-8-11(14)13-6-5-12-9(2)10(13)3/h4,9-10,12H,1,5-8H2,2-3H3 |
| InChIKey | JCXZTEBWCCRTQQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|