C7H14N2O2 — CID 126753910
2,3-dimethylpiperazine-1-carboxylic acid (PubChem CID 126753910) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,3-dimethylpiperazine-1-carboxylic acid.
| Compound Name | 2,3-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 126753910 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2,3-dimethylpiperazine-1-carboxylic acid |
| SMILES | CC1NCCN(C(=O)O)C1C |
| InChI | InChI=1S/C7H14N2O2/c1-5-6(2)9(7(10)11)4-3-8-5/h5-6,8H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | LKVMBSNHDKROIG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |