C17H15N3O3 — CID 18728981
ethyl 2-[4-[(4-cyanophenyl)diazenyl]-2,3,5,6-tetradeuteriophenoxy]acetate (PubChem CID 18728981) has the molecular formula C17H15N3O3 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl 2-[4-[(4-cyanophenyl)diazenyl]-2,3,5,6-tetradeuteriophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(4-cyanophenyl)diazenyl]-2,3,5,6-tetradeuteriophenoxy]acetate |
|---|---|
| PubChem CID | 18728981 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | ethyl 2-[4-[(4-cyanophenyl)diazenyl]-2,3,5,6-tetradeuteriophenoxy]acetate |
| SMILES | [2H]c1c([2H])c(OCC(=O)OCC)c([2H])c([2H])c1/N=N/c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H15N3O3/c1-2-22-17(21)12-23-16-9-7-15(8-10-16)20-19-14-5-3-13(11-18)4-6-14/h3-10H,2,12H2,1H3/b20-19+/i7D,8D,9D,10D |
| InChIKey | ZMJUZQJGKJXHOO-RBAQGSBPSA-N |
| XLogP | 3.92 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|