C20H17Cl2NO3 — CID 141173311
2-[2-chloro-3-[(4-chlorophenyl)methyl]-4,7-dimethylquinolin-5-yl]oxyacetic acid (PubChem CID 141173311) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-[2-chloro-3-[(4-chlorophenyl)methyl]-4,7-dimethylquinolin-5-yl]oxyacetic acid.
| Compound Name | 2-[2-chloro-3-[(4-chlorophenyl)methyl]-4,7-dimethylquinolin-5-yl]oxyacetic acid |
|---|---|
| PubChem CID | 141173311 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-[2-chloro-3-[(4-chlorophenyl)methyl]-4,7-dimethylquinolin-5-yl]oxyacetic acid |
| SMILES | Cc1cc(OCC(=O)O)c2c(C)c(Cc3ccc(Cl)cc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C20H17Cl2NO3/c1-11-7-16-19(17(8-11)26-10-18(24)25)12(2)15(20(22)23-16)9-13-3-5-14(21)6-4-13/h3-8H,9-10H2,1-2H3,(H,24,25) |
| InChIKey | ZDCDKYDMGBGDCZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|