C21H18ClFO5 — CID 1242638
methyl 2-[5-[(2-chloro-6-fluorophenyl)methoxy]-4,7-dimethyl-2-oxochromen-3-yl]acetate (PubChem CID 1242638) has the molecular formula C21H18ClFO5 and a molecular weight of 404.82 g/mol. Its IUPAC name is methyl 2-[5-[(2-chloro-6-fluorophenyl)methoxy]-4,7-dimethyl-2-oxochromen-3-yl]acetate.
| Compound Name | methyl 2-[5-[(2-chloro-6-fluorophenyl)methoxy]-4,7-dimethyl-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 1242638 |
| Molecular Formula | C21H18ClFO5 |
| Molecular Weight | 404.82 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | methyl 2-[5-[(2-chloro-6-fluorophenyl)methoxy]-4,7-dimethyl-2-oxochromen-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c2c(OCc3c(F)cccc3Cl)cc(C)cc2oc1=O |
| InChI | InChI=1S/C21H18ClFO5/c1-11-7-17(27-10-14-15(22)5-4-6-16(14)23)20-12(2)13(9-19(24)26-3)21(25)28-18(20)8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | DUFWMMINTYRDPQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|