3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid

C11H9ClO3 — CID 141393833

IUPAC3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid
SMILESCc1cc(C)c2c(Cl)c(C(=O)O)oc2c1
InChIInChI=1S/C11H9ClO3/c1-5-3-6(2)8-7(4-5)15-10(9(8)12)11(13)14/h3-4H,1-2H3,(H,13,14)
InChIKeyOBMGEWBPCUTGAD-UHFFFAOYSA-N
MW224.64 g/mol
LogP3.40
Rot. Bonds1

About 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid

3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid (PubChem CID 141393833) has the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. Its IUPAC name is 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid.

Molecular Properties

Compound Name3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid
PubChem CID141393833
Molecular FormulaC11H9ClO3
Molecular Weight224.64 g/mol
Exact Mass224.02
IUPAC Name3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid
SMILESCc1cc(C)c2c(Cl)c(C(=O)O)oc2c1
InChIInChI=1S/C11H9ClO3/c1-5-3-6(2)8-7(4-5)15-10(9(8)12)11(13)14/h3-4H,1-2H3,(H,13,14)
InChIKeyOBMGEWBPCUTGAD-UHFFFAOYSA-N
XLogP3.40
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.64
LogP ≤ 53.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid?
The IUPAC name of 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid (CID 141393833) is 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid.
What is the SMILES notation for 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid?
The canonical SMILES for 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid is Cc1cc(C)c2c(Cl)c(C(=O)O)oc2c1.
What is the InChIKey of 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid?
The InChIKey is OBMGEWBPCUTGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClO3/c1-5-3-6(2)8-7(4-5)15-10(9(8)12)11(13)14/h3-4H,1-2H3,(H,13,14).
What are the key properties of 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid?
3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid has a molecular weight of 224.64 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4,6-dimethyl-1-benzofuran-2-carboxylic acid is sourced from PubChem (CID 141393833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).