C11H10O4 — CID 84620641
3-hydroxy-4,6-dimethyl-1-benzofuran-2-carboxylic acid (PubChem CID 84620641) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-hydroxy-4,6-dimethyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-hydroxy-4,6-dimethyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 84620641 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-hydroxy-4,6-dimethyl-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1cc(C)c2c(O)c(C(=O)O)oc2c1 |
| InChI | InChI=1S/C11H10O4/c1-5-3-6(2)8-7(4-5)15-10(9(8)12)11(13)14/h3-4,12H,1-2H3,(H,13,14) |
| InChIKey | YCFJAHZVQIDMSX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |