C19H18O5 — CID 1413436
2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethylchromen-4-one (PubChem CID 1413436) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethylchromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 1413436 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethylchromen-4-one |
| SMILES | COc1ccc(-c2oc3cc(C)cc(C)c3c(=O)c2O)cc1OC |
| InChI | InChI=1S/C19H18O5/c1-10-7-11(2)16-15(8-10)24-19(18(21)17(16)20)12-5-6-13(22-3)14(9-12)23-4/h5-9,21H,1-4H3 |
| InChIKey | JENABMAPOQOCLM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |