C19H19NO4 — CID 6871166
(NE)-N-[2-(3,4-dimethoxyphenyl)-5,7-dimethylchromen-4-ylidene]hydroxylamine (PubChem CID 6871166) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (NE)-N-[2-(3,4-dimethoxyphenyl)-5,7-dimethylchromen-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-(3,4-dimethoxyphenyl)-5,7-dimethylchromen-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 6871166 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (NE)-N-[2-(3,4-dimethoxyphenyl)-5,7-dimethylchromen-4-ylidene]hydroxylamine |
| SMILES | COc1ccc(-c2c/c(=N\O)c3c(C)cc(C)cc3o2)cc1OC |
| InChI | InChI=1S/C19H19NO4/c1-11-7-12(2)19-14(20-21)10-16(24-18(19)8-11)13-5-6-15(22-3)17(9-13)23-4/h5-10,21H,1-4H3/b20-14+ |
| InChIKey | IKDOKXDXSHXTQB-XSFVSMFZSA-N |
| XLogP | 4.02 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|