C23H27NO5 — CID 7729855
2-[2-[[2-(3,4-dimethoxyphenyl)-5,7-dimethylchromen-4-ylidene]amino]ethoxy]ethanol (PubChem CID 7729855) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[2-[[2-(3,4-dimethoxyphenyl)-5,7-dimethylchromen-4-ylidene]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[2-(3,4-dimethoxyphenyl)-5,7-dimethylchromen-4-ylidene]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 7729855 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[2-[[2-(3,4-dimethoxyphenyl)-5,7-dimethylchromen-4-ylidene]amino]ethoxy]ethanol |
| SMILES | COc1ccc(-c2c/c(=N\CCOCCO)c3c(C)cc(C)cc3o2)cc1OC |
| InChI | InChI=1S/C23H27NO5/c1-15-11-16(2)23-18(24-7-9-28-10-8-25)14-20(29-22(23)12-15)17-5-6-19(26-3)21(13-17)27-4/h5-6,11-14,25H,7-10H2,1-4H3/b24-18+ |
| InChIKey | LPRSKJZLFCYUBT-HKOYGPOVSA-N |
| XLogP | 3.64 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|