C24H27NO4 — CID 20998852
2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-(oxolan-2-ylmethyl)chromen-4-imine (PubChem CID 20998852) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-(oxolan-2-ylmethyl)chromen-4-imine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-(oxolan-2-ylmethyl)chromen-4-imine |
|---|---|
| PubChem CID | 20998852 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-(oxolan-2-ylmethyl)chromen-4-imine |
| SMILES | COc1ccc(-c2c/c(=N\CC3CCCO3)c3c(C)cc(C)cc3o2)cc1OC |
| InChI | InChI=1S/C24H27NO4/c1-15-10-16(2)24-19(25-14-18-6-5-9-28-18)13-21(29-23(24)11-15)17-7-8-20(26-3)22(12-17)27-4/h7-8,10-13,18H,5-6,9,14H2,1-4H3/b25-19+ |
| InChIKey | RWNRSIULJIALHC-NCELDCMTSA-N |
| XLogP | 4.81 |
| TPSA | 53.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |