C22H23NO2 — CID 5146613
6-methyl-2-(4-methylphenyl)-N-(oxolan-2-ylmethyl)chromen-4-imine (PubChem CID 5146613) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 6-methyl-2-(4-methylphenyl)-N-(oxolan-2-ylmethyl)chromen-4-imine.
| Compound Name | 6-methyl-2-(4-methylphenyl)-N-(oxolan-2-ylmethyl)chromen-4-imine |
|---|---|
| PubChem CID | 5146613 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 6-methyl-2-(4-methylphenyl)-N-(oxolan-2-ylmethyl)chromen-4-imine |
| SMILES | Cc1ccc(-c2c/c(=N\CC3CCCO3)c3cc(C)ccc3o2)cc1 |
| InChI | InChI=1S/C22H23NO2/c1-15-5-8-17(9-6-15)22-13-20(23-14-18-4-3-11-24-18)19-12-16(2)7-10-21(19)25-22/h5-10,12-13,18H,3-4,11,14H2,1-2H3/b23-20+ |
| InChIKey | OHCCPYXQAKBGHH-BSYVCWPDSA-N |
| XLogP | 4.80 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |