C21H22ClNO5 — CID 20998154
1-[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]pyrrolidin-1-ium perchlorate (PubChem CID 20998154) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is 1-[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]pyrrolidin-1-ium perchlorate.
| Compound Name | 1-[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]pyrrolidin-1-ium perchlorate |
|---|---|
| PubChem CID | 20998154 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]pyrrolidin-1-ium perchlorate |
| SMILES | Cc1ccc(-c2cc(=[N+]3CCCC3)c3cc(C)ccc3o2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H22NO.ClHO4/c1-15-5-8-17(9-6-15)21-14-19(22-11-3-4-12-22)18-13-16(2)7-10-20(18)23-21;2-1(3,4)5/h5-10,13-14H,3-4,11-12H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | NWVRNDSFOYOOBI-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 108.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|