C20H20ClNO8 — CID 20998297
2-(4-methoxyphenyl)-4-morpholin-4-ium-4-ylidenechromen-6-ol perchlorate (PubChem CID 20998297) has the molecular formula C20H20ClNO8 and a molecular weight of 437.83 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-morpholin-4-ium-4-ylidenechromen-6-ol perchlorate.
| Compound Name | 2-(4-methoxyphenyl)-4-morpholin-4-ium-4-ylidenechromen-6-ol perchlorate |
|---|---|
| PubChem CID | 20998297 |
| Molecular Formula | C20H20ClNO8 |
| Molecular Weight | 437.83 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-morpholin-4-ium-4-ylidenechromen-6-ol perchlorate |
| SMILES | COc1ccc(-c2cc(=[N+]3CCOCC3)c3cc(O)ccc3o2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H19NO4.ClHO4/c1-23-16-5-2-14(3-6-16)20-13-18(21-8-10-24-11-9-21)17-12-15(22)4-7-19(17)25-20;2-1(3,4)5/h2-7,12-13H,8-11H2,1H3;(H,2,3,4,5) |
| InChIKey | DIJUFXUACWOUSB-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 147.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.83 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|