C22H18BF4NO3 — CID 23411881
(3-hydroxyphenyl)-[2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate (PubChem CID 23411881) has the molecular formula C22H18BF4NO3 and a molecular weight of 431.19 g/mol. Its IUPAC name is (3-hydroxyphenyl)-[2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate.
| Compound Name | (3-hydroxyphenyl)-[2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 23411881 |
| Molecular Formula | C22H18BF4NO3 |
| Molecular Weight | 431.19 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (3-hydroxyphenyl)-[2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate |
| SMILES | COc1ccc(-c2c/c(=[NH+]\c3cccc(O)c3)c3ccccc3o2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C22H17NO3.BF4/c1-25-18-11-9-15(10-12-18)22-14-20(19-7-2-3-8-21(19)26-22)23-16-5-4-6-17(24)13-16;2-1(3,4)5/h2-14,24H,1H3;/q;-1/p+1/b23-20+; |
| InChIKey | OAMHYONZRJVYFQ-NMSJBYGBSA-O |
| XLogP | 4.43 |
| TPSA | 56.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.19 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|