C24H21BClF4NO2 — CID 20997947
(3-chlorophenyl)-[6-ethyl-2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate (PubChem CID 20997947) has the molecular formula C24H21BClF4NO2 and a molecular weight of 477.69 g/mol. Its IUPAC name is (3-chlorophenyl)-[6-ethyl-2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate.
| Compound Name | (3-chlorophenyl)-[6-ethyl-2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 20997947 |
| Molecular Formula | C24H21BClF4NO2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | (3-chlorophenyl)-[6-ethyl-2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate |
| SMILES | CCc1ccc2oc(-c3ccc(OC)cc3)c/c(=[NH+]\c3cccc(Cl)c3)c2c1.F[B-](F)(F)F |
| InChI | InChI=1S/C24H20ClNO2.BF4/c1-3-16-7-12-23-21(13-16)22(26-19-6-4-5-18(25)14-19)15-24(28-23)17-8-10-20(27-2)11-9-17;2-1(3,4)5/h4-15H,3H2,1-2H3;/q;-1/p+1/b26-22+; |
| InChIKey | RZQFRHWGENRLHD-LIUXSCBKSA-O |
| XLogP | 5.94 |
| TPSA | 36.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|