C24H23N2O2+ — CID 1193926
[6-ethyl-2-(4-methoxyphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium (PubChem CID 1193926) has the molecular formula C24H23N2O2+ and a molecular weight of 371.46 g/mol. Its IUPAC name is [6-ethyl-2-(4-methoxyphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium.
| Compound Name | [6-ethyl-2-(4-methoxyphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 1193926 |
| Molecular Formula | C24H23N2O2+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [6-ethyl-2-(4-methoxyphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium |
| SMILES | CCc1ccc2oc(-c3ccc(OC)cc3)c/c(=[NH+]\Cc3cccnc3)c2c1 |
| InChI | InChI=1S/C24H22N2O2/c1-3-17-6-11-23-21(13-17)22(26-16-18-5-4-12-25-15-18)14-24(28-23)19-7-9-20(27-2)10-8-19/h4-15H,3,16H2,1-2H3/p+1/b26-22+ |
| InChIKey | CPXJGNBQXOGFBX-XTCLZLMSSA-O |
| XLogP | 3.25 |
| TPSA | 49.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |