C23H19Cl2NO6 — CID 20999004
benzyl-[2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]azanium perchlorate (PubChem CID 20999004) has the molecular formula C23H19Cl2NO6 and a molecular weight of 476.31 g/mol. Its IUPAC name is benzyl-[2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]azanium perchlorate.
| Compound Name | benzyl-[2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]azanium perchlorate |
|---|---|
| PubChem CID | 20999004 |
| Molecular Formula | C23H19Cl2NO6 |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | benzyl-[2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]azanium perchlorate |
| SMILES | COc1ccc2oc(-c3ccccc3Cl)c/c(=[NH+]\Cc3ccccc3)c2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H18ClNO2.ClHO4/c1-26-17-11-12-22-19(13-17)21(25-15-16-7-3-2-4-8-16)14-23(27-22)18-9-5-6-10-20(18)24;2-1(3,4)5/h2-14H,15H2,1H3;(H,2,3,4,5)/b25-21+; |
| InChIKey | NENGXOHMRFZBJZ-JMFMGIQESA-N |
| XLogP | -0.81 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |