C26H19Cl2NO6 — CID 20999011
[2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-naphthalen-1-ylazanium perchlorate (PubChem CID 20999011) has the molecular formula C26H19Cl2NO6 and a molecular weight of 512.35 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-naphthalen-1-ylazanium perchlorate.
| Compound Name | [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-naphthalen-1-ylazanium perchlorate |
|---|---|
| PubChem CID | 20999011 |
| Molecular Formula | C26H19Cl2NO6 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-naphthalen-1-ylazanium perchlorate |
| SMILES | COc1ccc2oc(-c3ccccc3Cl)c/c(=[NH+]\c3cccc4ccccc34)c2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C26H18ClNO2.ClHO4/c1-29-18-13-14-25-21(15-18)24(16-26(30-25)20-10-4-5-11-22(20)27)28-23-12-6-8-17-7-2-3-9-19(17)23;2-1(3,4)5/h2-16H,1H3;(H,2,3,4,5)/b28-24+; |
| InChIKey | ADNBKTAGFCNUIS-YTGAECEWSA-N |
| XLogP | 0.47 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |