C24H21Cl2NO7 — CID 20999018
[2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-(4-ethoxyphenyl)azanium perchlorate (PubChem CID 20999018) has the molecular formula C24H21Cl2NO7 and a molecular weight of 506.34 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-(4-ethoxyphenyl)azanium perchlorate.
| Compound Name | [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-(4-ethoxyphenyl)azanium perchlorate |
|---|---|
| PubChem CID | 20999018 |
| Molecular Formula | C24H21Cl2NO7 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-(4-ethoxyphenyl)azanium perchlorate |
| SMILES | CCOc1ccc(/[NH+]=c2\cc(-c3ccccc3Cl)oc3ccc(OC)cc23)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H20ClNO3.ClHO4/c1-3-28-17-10-8-16(9-11-17)26-22-15-24(19-6-4-5-7-21(19)25)29-23-13-12-18(27-2)14-20(22)23;2-1(3,4)5/h4-15H,3H2,1-2H3;(H,2,3,4,5)/b26-22+; |
| InChIKey | LKEBAFQSNXKHNP-LIUXSCBKSA-N |
| XLogP | -0.28 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |