C24H21Cl2NO6 — CID 20999006
[2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-(2-phenylethyl)azanium perchlorate (PubChem CID 20999006) has the molecular formula C24H21Cl2NO6 and a molecular weight of 490.34 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-(2-phenylethyl)azanium perchlorate.
| Compound Name | [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-(2-phenylethyl)azanium perchlorate |
|---|---|
| PubChem CID | 20999006 |
| Molecular Formula | C24H21Cl2NO6 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | [2-(2-chlorophenyl)-6-methoxychromen-4-ylidene]-(2-phenylethyl)azanium perchlorate |
| SMILES | COc1ccc2oc(-c3ccccc3Cl)c/c(=[NH+]\CCc3ccccc3)c2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H20ClNO2.ClHO4/c1-27-18-11-12-23-20(15-18)22(26-14-13-17-7-3-2-4-8-17)16-24(28-23)19-9-5-6-10-21(19)25;2-1(3,4)5/h2-12,15-16H,13-14H2,1H3;(H,2,3,4,5)/b26-22+; |
| InChIKey | BBSUNQFGMSBNGJ-LIUXSCBKSA-N |
| XLogP | -0.77 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |