C20H22ClNO6 — CID 88787029
butyl-[2-(2-methoxyphenyl)chromen-4-ylidene]azanium perchlorate (PubChem CID 88787029) has the molecular formula C20H22ClNO6 and a molecular weight of 407.85 g/mol. Its IUPAC name is butyl-[2-(2-methoxyphenyl)chromen-4-ylidene]azanium perchlorate.
| Compound Name | butyl-[2-(2-methoxyphenyl)chromen-4-ylidene]azanium perchlorate |
|---|---|
| PubChem CID | 88787029 |
| Molecular Formula | C20H22ClNO6 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | butyl-[2-(2-methoxyphenyl)chromen-4-ylidene]azanium perchlorate |
| SMILES | CCCC/[NH+]=c1\cc(-c2ccccc2OC)oc2ccccc12.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H21NO2.ClHO4/c1-3-4-13-21-17-14-20(16-10-6-7-11-18(16)22-2)23-19-12-8-5-9-15(17)19;2-1(3,4)5/h5-12,14H,3-4,13H2,1-2H3;(H,2,3,4,5)/b21-17+; |
| InChIKey | AFKVFFSYJBFNQN-DIRYEVLESA-N |
| XLogP | -1.87 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|