C22H26Cl2N2O7 — CID 20998909
[6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]-[3-(dimethylamino)propyl]azanium perchlorate (PubChem CID 20998909) has the molecular formula C22H26Cl2N2O7 and a molecular weight of 501.36 g/mol. Its IUPAC name is [6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]-[3-(dimethylamino)propyl]azanium perchlorate.
| Compound Name | [6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]-[3-(dimethylamino)propyl]azanium perchlorate |
|---|---|
| PubChem CID | 20998909 |
| Molecular Formula | C22H26Cl2N2O7 |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | [6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]-[3-(dimethylamino)propyl]azanium perchlorate |
| SMILES | COc1ccc(-c2c/c(=[NH+]\CCCN(C)C)c3cc(Cl)ccc3o2)cc1OC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H25ClN2O3.ClHO4/c1-25(2)11-5-10-24-18-14-21(28-19-9-7-16(23)13-17(18)19)15-6-8-20(26-3)22(12-15)27-4;2-1(3,4)5/h6-9,12-14H,5,10-11H2,1-4H3;(H,2,3,4,5)/b24-18+; |
| InChIKey | CHMCZJCCLZLBCM-NDUABGMUSA-N |
| XLogP | -2.05 |
| TPSA | 141.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|