C21H23Cl2NO8 — CID 20998908
[6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]-(3-methoxypropyl)azanium perchlorate (PubChem CID 20998908) has the molecular formula C21H23Cl2NO8 and a molecular weight of 488.32 g/mol. Its IUPAC name is [6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]-(3-methoxypropyl)azanium perchlorate.
| Compound Name | [6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]-(3-methoxypropyl)azanium perchlorate |
|---|---|
| PubChem CID | 20998908 |
| Molecular Formula | C21H23Cl2NO8 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | [6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]-(3-methoxypropyl)azanium perchlorate |
| SMILES | COCCC/[NH+]=c1\cc(-c2ccc(OC)c(OC)c2)oc2ccc(Cl)cc12.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H22ClNO4.ClHO4/c1-24-10-4-9-23-17-13-20(27-18-8-6-15(22)12-16(17)18)14-5-7-19(25-2)21(11-14)26-3;2-1(3,4)5/h5-8,11-13H,4,9-10H2,1-3H3;(H,2,3,4,5)/b23-17+; |
| InChIKey | OHZFHHNNVVUAQB-YFZNFVDXSA-N |
| XLogP | -1.97 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|