C22H24ClNO8 — CID 20998221
4-[2-(3,4-dimethoxyphenyl)-6-methylchromen-4-ylidene]morpholin-4-ium perchlorate (PubChem CID 20998221) has the molecular formula C22H24ClNO8 and a molecular weight of 465.89 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)-6-methylchromen-4-ylidene]morpholin-4-ium perchlorate.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)-6-methylchromen-4-ylidene]morpholin-4-ium perchlorate |
|---|---|
| PubChem CID | 20998221 |
| Molecular Formula | C22H24ClNO8 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)-6-methylchromen-4-ylidene]morpholin-4-ium perchlorate |
| SMILES | COc1ccc(-c2cc(=[N+]3CCOCC3)c3cc(C)ccc3o2)cc1OC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H24NO4.ClHO4/c1-15-4-6-19-17(12-15)18(23-8-10-26-11-9-23)14-21(27-19)16-5-7-20(24-2)22(13-16)25-3;2-1(3,4)5/h4-7,12-14H,8-11H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | RYDMBAVTZIHIGG-UHFFFAOYSA-M |
| XLogP | -1.53 |
| TPSA | 136.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|