C21H22ClNO6 — CID 86247105
1-[2-(4-methoxyphenyl)chromen-4-ylidene]piperidin-1-ium perchlorate (PubChem CID 86247105) has the molecular formula C21H22ClNO6 and a molecular weight of 419.86 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)chromen-4-ylidene]piperidin-1-ium perchlorate.
| Compound Name | 1-[2-(4-methoxyphenyl)chromen-4-ylidene]piperidin-1-ium perchlorate |
|---|---|
| PubChem CID | 86247105 |
| Molecular Formula | C21H22ClNO6 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)chromen-4-ylidene]piperidin-1-ium perchlorate |
| SMILES | COc1ccc(-c2cc(=[N+]3CCCCC3)c3ccccc3o2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H22NO2.ClHO4/c1-23-17-11-9-16(10-12-17)21-15-19(22-13-5-2-6-14-22)18-7-3-4-8-20(18)24-21;2-1(3,4)5/h3-4,7-12,15H,2,5-6,13-14H2,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KGHGRIHUIRYENI-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 117.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|