C23H20O4 — CID 71608239
3-(3,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-1-benzofuran (PubChem CID 71608239) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-1-benzofuran.
| Compound Name | 3-(3,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-1-benzofuran |
|---|---|
| PubChem CID | 71608239 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-1-benzofuran |
| SMILES | COc1ccc(-c2oc3ccccc3c2-c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C23H20O4/c1-24-17-10-8-15(9-11-17)23-22(20-6-4-5-7-21(20)27-23)16-12-18(25-2)14-19(13-16)26-3/h4-14H,1-3H3 |
| InChIKey | AUPMKIKZBNJYCM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |