C26H25NO4 — CID 25011565
4-[2,3-bis(4-methoxyphenyl)-1-benzofuran-5-yl]morpholine (PubChem CID 25011565) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-[2,3-bis(4-methoxyphenyl)-1-benzofuran-5-yl]morpholine.
| Compound Name | 4-[2,3-bis(4-methoxyphenyl)-1-benzofuran-5-yl]morpholine |
|---|---|
| PubChem CID | 25011565 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-[2,3-bis(4-methoxyphenyl)-1-benzofuran-5-yl]morpholine |
| SMILES | COc1ccc(-c2oc3ccc(N4CCOCC4)cc3c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H25NO4/c1-28-21-8-3-18(4-9-21)25-23-17-20(27-13-15-30-16-14-27)7-12-24(23)31-26(25)19-5-10-22(29-2)11-6-19/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | WUYQZCXEESNKQZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 44.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |