C16H13BrO3 — CID 89479970
3-bromo-5-methoxy-2-(4-methoxyphenyl)-1-benzofuran (PubChem CID 89479970) has the molecular formula C16H13BrO3 and a molecular weight of 333.18 g/mol. Its IUPAC name is 3-bromo-5-methoxy-2-(4-methoxyphenyl)-1-benzofuran.
| Compound Name | 3-bromo-5-methoxy-2-(4-methoxyphenyl)-1-benzofuran |
|---|---|
| PubChem CID | 89479970 |
| Molecular Formula | C16H13BrO3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 3-bromo-5-methoxy-2-(4-methoxyphenyl)-1-benzofuran |
| SMILES | COc1ccc(-c2oc3ccc(OC)cc3c2Br)cc1 |
| InChI | InChI=1S/C16H13BrO3/c1-18-11-5-3-10(4-6-11)16-15(17)13-9-12(19-2)7-8-14(13)20-16/h3-9H,1-2H3 |
| InChIKey | JENSIBCYTSRFLG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |