C27H25NO5 — CID 175951658
2-(4-hydroxyphenyl)-5,7-dimethoxy-3-(4-pyrrolidin-1-ylphenyl)chromen-4-one (PubChem CID 175951658) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-5,7-dimethoxy-3-(4-pyrrolidin-1-ylphenyl)chromen-4-one.
| Compound Name | 2-(4-hydroxyphenyl)-5,7-dimethoxy-3-(4-pyrrolidin-1-ylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 175951658 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(4-hydroxyphenyl)-5,7-dimethoxy-3-(4-pyrrolidin-1-ylphenyl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(-c3ccc(N4CCCC4)cc3)c(-c3ccc(O)cc3)oc2c1 |
| InChI | InChI=1S/C27H25NO5/c1-31-21-15-22(32-2)25-23(16-21)33-27(18-7-11-20(29)12-8-18)24(26(25)30)17-5-9-19(10-6-17)28-13-3-4-14-28/h5-12,15-16,29H,3-4,13-14H2,1-2H3 |
| InChIKey | GCHZJKJEIJQYIE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |