C26H22O7 — CID 134911539
benzyl 5,7-dimethoxy-2-(4-methoxyphenyl)-4-oxochromene-3-carboxylate (PubChem CID 134911539) has the molecular formula C26H22O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is benzyl 5,7-dimethoxy-2-(4-methoxyphenyl)-4-oxochromene-3-carboxylate.
| Compound Name | benzyl 5,7-dimethoxy-2-(4-methoxyphenyl)-4-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 134911539 |
| Molecular Formula | C26H22O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | benzyl 5,7-dimethoxy-2-(4-methoxyphenyl)-4-oxochromene-3-carboxylate |
| SMILES | COc1ccc(-c2oc3cc(OC)cc(OC)c3c(=O)c2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H22O7/c1-29-18-11-9-17(10-12-18)25-23(26(28)32-15-16-7-5-4-6-8-16)24(27)22-20(31-3)13-19(30-2)14-21(22)33-25/h4-14H,15H2,1-3H3 |
| InChIKey | RZBXPBGGJJYEIH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |