methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate

C24H18O5 — CID 14791371

IUPACmethyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate
SMILESCOC(=O)c1c(-c2ccc(OCc3ccccc3)cc2)oc2ccccc2c1=O
InChIInChI=1S/C24H18O5/c1-27-24(26)21-22(25)19-9-5-6-10-20(19)29-23(21)17-11-13-18(14-12-17)28-15-16-7-3-2-4-8-16/h2-14H,15H2,1H3
InChIKeyPVJFVQYTULRGST-UHFFFAOYSA-N
MW386.40 g/mol
LogP4.83
Rot. Bonds5

About methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate

methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate (PubChem CID 14791371) has the molecular formula C24H18O5 and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate
PubChem CID14791371
Molecular FormulaC24H18O5
Molecular Weight386.40 g/mol
Exact Mass386.12
IUPAC Namemethyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate
SMILESCOC(=O)c1c(-c2ccc(OCc3ccccc3)cc2)oc2ccccc2c1=O
InChIInChI=1S/C24H18O5/c1-27-24(26)21-22(25)19-9-5-6-10-20(19)29-23(21)17-11-13-18(14-12-17)28-15-16-7-3-2-4-8-16/h2-14H,15H2,1H3
InChIKeyPVJFVQYTULRGST-UHFFFAOYSA-N
XLogP4.83
TPSA65.74 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500386.40
LogP ≤ 54.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate?
The IUPAC name of methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate (CID 14791371) is methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate.
What is the SMILES notation for methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate?
The canonical SMILES for methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate is COC(=O)c1c(-c2ccc(OCc3ccccc3)cc2)oc2ccccc2c1=O.
What is the InChIKey of methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate?
The InChIKey is PVJFVQYTULRGST-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O5/c1-27-24(26)21-22(25)19-9-5-6-10-20(19)29-23(21)17-11-13-18(14-12-17)28-15-16-7-3-2-4-8-16/h2-14H,15H2,1H3.
What are the key properties of methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate?
methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate has a molecular weight of 386.40 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-2-(4-phenylmethoxyphenyl)chromene-3-carboxylate is sourced from PubChem (CID 14791371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).