C24H20O5 — CID 68682648
ethyl 5-hydroxy-2-(4-phenylmethoxyphenyl)-1-benzofuran-3-carboxylate (PubChem CID 68682648) has the molecular formula C24H20O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 5-hydroxy-2-(4-phenylmethoxyphenyl)-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-2-(4-phenylmethoxyphenyl)-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 68682648 |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | ethyl 5-hydroxy-2-(4-phenylmethoxyphenyl)-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OCc3ccccc3)cc2)oc2ccc(O)cc12 |
| InChI | InChI=1S/C24H20O5/c1-2-27-24(26)22-20-14-18(25)10-13-21(20)29-23(22)17-8-11-19(12-9-17)28-15-16-6-4-3-5-7-16/h3-14,25H,2,15H2,1H3 |
| InChIKey | LGKYTODMJXGUDU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |