C19H16O4S2 — CID 87539662
ethyl 2-phenyl-5-(2-sulfanylethanethioyl)oxy-1-benzofuran-3-carboxylate (PubChem CID 87539662) has the molecular formula C19H16O4S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is ethyl 2-phenyl-5-(2-sulfanylethanethioyl)oxy-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-phenyl-5-(2-sulfanylethanethioyl)oxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 87539662 |
| Molecular Formula | C19H16O4S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | ethyl 2-phenyl-5-(2-sulfanylethanethioyl)oxy-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(OC(=S)CS)cc12 |
| InChI | InChI=1S/C19H16O4S2/c1-2-21-19(20)17-14-10-13(22-16(25)11-24)8-9-15(14)23-18(17)12-6-4-3-5-7-12/h3-10,24H,2,11H2,1H3 |
| InChIKey | WZDMGGAIGGGEAJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|