C26H24O5 — CID 2432828
ethyl 5-[2-(3-methylphenoxy)ethoxy]-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 2432828) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is ethyl 5-[2-(3-methylphenoxy)ethoxy]-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[2-(3-methylphenoxy)ethoxy]-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 2432828 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | ethyl 5-[2-(3-methylphenoxy)ethoxy]-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(OCCOc3cccc(C)c3)cc12 |
| InChI | InChI=1S/C26H24O5/c1-3-28-26(27)24-22-17-21(30-15-14-29-20-11-7-8-18(2)16-20)12-13-23(22)31-25(24)19-9-5-4-6-10-19/h4-13,16-17H,3,14-15H2,1-2H3 |
| InChIKey | QSPSXKPBJZUOCF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|