C21H18O5 — CID 7942364
ethyl 5-(cyclopropanecarbonyloxy)-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 7942364) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is ethyl 5-(cyclopropanecarbonyloxy)-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-(cyclopropanecarbonyloxy)-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 7942364 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | ethyl 5-(cyclopropanecarbonyloxy)-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(OC(=O)C3CC3)cc12 |
| InChI | InChI=1S/C21H18O5/c1-2-24-21(23)18-16-12-15(25-20(22)14-8-9-14)10-11-17(16)26-19(18)13-6-4-3-5-7-13/h3-7,10-12,14H,2,8-9H2,1H3 |
| InChIKey | VGLYLCSSRJCPDT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|