C24H20NO6- — CID 163177086
ethyl 5-[[3-[hydroxy(oxido)amino]phenyl]methoxy]-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 163177086) has the molecular formula C24H20NO6- and a molecular weight of 418.43 g/mol. Its IUPAC name is ethyl 5-[[3-[hydroxy(oxido)amino]phenyl]methoxy]-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[[3-[hydroxy(oxido)amino]phenyl]methoxy]-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 163177086 |
| Molecular Formula | C24H20NO6- |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | ethyl 5-[[3-[hydroxy(oxido)amino]phenyl]methoxy]-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(OCc3cccc(N([O-])O)c3)cc12 |
| InChI | InChI=1S/C24H20NO6/c1-2-29-24(26)22-20-14-19(30-15-16-7-6-10-18(13-16)25(27)28)11-12-21(20)31-23(22)17-8-4-3-5-9-17/h3-14,27H,2,15H2,1H3/q-1 |
| InChIKey | ARKADLVMTOWTBH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|