C23H17FO5 — CID 70688323
5-[(3-fluorophenyl)methoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylic acid (PubChem CID 70688323) has the molecular formula C23H17FO5 and a molecular weight of 392.38 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylic acid.
| Compound Name | 5-[(3-fluorophenyl)methoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 70688323 |
| Molecular Formula | C23H17FO5 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 5-[(3-fluorophenyl)methoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylic acid |
| SMILES | COc1ccc(-c2oc3ccc(OCc4cccc(F)c4)cc3c2C(=O)O)cc1 |
| InChI | InChI=1S/C23H17FO5/c1-27-17-7-5-15(6-8-17)22-21(23(25)26)19-12-18(9-10-20(19)29-22)28-13-14-3-2-4-16(24)11-14/h2-12H,13H2,1H3,(H,25,26) |
| InChIKey | IQWDKPLQTHOYBS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |