C18H15FO5 — CID 70908973
2-[[2-(4-fluorophenyl)-3-(methoxymethyl)-1-benzofuran-5-yl]oxy]acetic acid (PubChem CID 70908973) has the molecular formula C18H15FO5 and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-3-(methoxymethyl)-1-benzofuran-5-yl]oxy]acetic acid.
| Compound Name | 2-[[2-(4-fluorophenyl)-3-(methoxymethyl)-1-benzofuran-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 70908973 |
| Molecular Formula | C18H15FO5 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-3-(methoxymethyl)-1-benzofuran-5-yl]oxy]acetic acid |
| SMILES | COCc1c(-c2ccc(F)cc2)oc2ccc(OCC(=O)O)cc12 |
| InChI | InChI=1S/C18H15FO5/c1-22-9-15-14-8-13(23-10-17(20)21)6-7-16(14)24-18(15)11-2-4-12(19)5-3-11/h2-8H,9-10H2,1H3,(H,20,21) |
| InChIKey | APZCTIUZHOOVNQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |