C19H15FO4 — CID 68719193
methyl 2-(4-fluorophenyl)-5-prop-2-enoxy-1-benzofuran-3-carboxylate (PubChem CID 68719193) has the molecular formula C19H15FO4 and a molecular weight of 326.32 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)-5-prop-2-enoxy-1-benzofuran-3-carboxylate.
| Compound Name | methyl 2-(4-fluorophenyl)-5-prop-2-enoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 68719193 |
| Molecular Formula | C19H15FO4 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | methyl 2-(4-fluorophenyl)-5-prop-2-enoxy-1-benzofuran-3-carboxylate |
| SMILES | C=CCOc1ccc2oc(-c3ccc(F)cc3)c(C(=O)OC)c2c1 |
| InChI | InChI=1S/C19H15FO4/c1-3-10-23-14-8-9-16-15(11-14)17(19(21)22-2)18(24-16)12-4-6-13(20)7-5-12/h3-9,11H,1,10H2,2H3 |
| InChIKey | CASLIEGBDFFAMI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|